C16H15N3O — CID 14708613
1-ethyl-2,5-diphenyl-1,2,4-triazol-3-one (PubChem CID 14708613) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-ethyl-2,5-diphenyl-1,2,4-triazol-3-one.
| Compound Name | 1-ethyl-2,5-diphenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 14708613 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-ethyl-2,5-diphenyl-1,2,4-triazol-3-one |
| SMILES | CCn1c(-c2ccccc2)nc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H15N3O/c1-2-18-15(13-9-5-3-6-10-13)17-16(20)19(18)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | DPLKXVNHRIXMHE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |