C10H8N3O3- — CID 71434654
2-methyl-5-oxo-1-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 71434654) has the molecular formula C10H8N3O3- and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-methyl-5-oxo-1-phenyl-1,2,4-triazole-3-carboxylate.
| Compound Name | 2-methyl-5-oxo-1-phenyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 71434654 |
| Molecular Formula | C10H8N3O3- |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-methyl-5-oxo-1-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1c(C(=O)[O-])nc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C10H9N3O3/c1-12-8(9(14)15)11-10(16)13(12)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)/p-1 |
| InChIKey | CUZOPJUWFLLCFQ-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |