C20H14ClN3O — CID 134915399
2-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-3-one (PubChem CID 134915399) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 134915399 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-3-one |
| SMILES | O=c1nc(-c2ccccc2)n(-c2ccccc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O/c21-16-11-13-18(14-12-16)24-20(25)22-19(15-7-3-1-4-8-15)23(24)17-9-5-2-6-10-17/h1-14H |
| InChIKey | UPEBMTDDKDCGOF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |