C12H9ClF3NO — CID 66696645
2-chloro-4-ethyl-5-[4-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 66696645) has the molecular formula C12H9ClF3NO and a molecular weight of 275.66 g/mol. Its IUPAC name is 2-chloro-4-ethyl-5-[4-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 2-chloro-4-ethyl-5-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66696645 |
| Molecular Formula | C12H9ClF3NO |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-chloro-4-ethyl-5-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | CCc1nc(Cl)oc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9ClF3NO/c1-2-9-10(18-11(13)17-9)7-3-5-8(6-4-7)12(14,15)16/h3-6H,2H2,1H3 |
| InChIKey | MLUYRDYFLINTTB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |