C15H14N2O2 — CID 666997
4-(imidazol-1-ylmethyl)-6,7-dimethylchromen-2-one (PubChem CID 666997) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-6,7-dimethylchromen-2-one.
| Compound Name | 4-(imidazol-1-ylmethyl)-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 666997 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(Cn3ccnc3)c2cc1C |
| InChI | InChI=1S/C15H14N2O2/c1-10-5-13-12(8-17-4-3-16-9-17)7-15(18)19-14(13)6-11(10)2/h3-7,9H,8H2,1-2H3 |
| InChIKey | HDPFRGSCSFYTGD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|