C17H14F3N3O2S — CID 66700161
[1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[3-(4-methylphenyl)thiophen-2-yl]carbamate (PubChem CID 66700161) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[3-(4-methylphenyl)thiophen-2-yl]carbamate.
| Compound Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[3-(4-methylphenyl)thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 66700161 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[3-(4-methylphenyl)thiophen-2-yl]carbamate |
| SMILES | Cc1ccc(-c2ccsc2NC(=O)Oc2cn(C)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-10-3-5-11(6-4-10)12-7-8-26-15(12)21-16(24)25-13-9-23(2)22-14(13)17(18,19)20/h3-9H,1-2H3,(H,21,24) |
| InChIKey | SCRNBYACBMYEJR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |