C19H16F3N3O4S — CID 69196450
[1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[2-(4-methylsulfonylphenyl)phenyl]carbamate (PubChem CID 69196450) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[2-(4-methylsulfonylphenyl)phenyl]carbamate.
| Compound Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[2-(4-methylsulfonylphenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 69196450 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl] N-[2-(4-methylsulfonylphenyl)phenyl]carbamate |
| SMILES | Cn1cc(OC(=O)Nc2ccccc2-c2ccc(S(C)(=O)=O)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H16F3N3O4S/c1-25-11-16(17(24-25)19(20,21)22)29-18(26)23-15-6-4-3-5-14(15)12-7-9-13(10-8-12)30(2,27)28/h3-11H,1-2H3,(H,23,26) |
| InChIKey | AHKGTZMTQMVYMC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |