C19H16ClFN2O2 — CID 68882502
[4-(fluoromethyl)-1-methylpyrrol-3-yl] N-[2-(4-chlorophenyl)phenyl]carbamate (PubChem CID 68882502) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is [4-(fluoromethyl)-1-methylpyrrol-3-yl] N-[2-(4-chlorophenyl)phenyl]carbamate.
| Compound Name | [4-(fluoromethyl)-1-methylpyrrol-3-yl] N-[2-(4-chlorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 68882502 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [4-(fluoromethyl)-1-methylpyrrol-3-yl] N-[2-(4-chlorophenyl)phenyl]carbamate |
| SMILES | Cn1cc(CF)c(OC(=O)Nc2ccccc2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H16ClFN2O2/c1-23-11-14(10-21)18(12-23)25-19(24)22-17-5-3-2-4-16(17)13-6-8-15(20)9-7-13/h2-9,11-12H,10H2,1H3,(H,22,24) |
| InChIKey | URPUQXLNLDBMCI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |