C19H18ClN3O2 — CID 66704005
6-chloro-N,N-diethyl-4-(4-nitrophenyl)quinolin-2-amine (PubChem CID 66704005) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 6-chloro-N,N-diethyl-4-(4-nitrophenyl)quinolin-2-amine.
| Compound Name | 6-chloro-N,N-diethyl-4-(4-nitrophenyl)quinolin-2-amine |
|---|---|
| PubChem CID | 66704005 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 6-chloro-N,N-diethyl-4-(4-nitrophenyl)quinolin-2-amine |
| SMILES | CCN(CC)c1cc(-c2ccc([N+](=O)[O-])cc2)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-3-22(4-2)19-12-16(13-5-8-15(9-6-13)23(24)25)17-11-14(20)7-10-18(17)21-19/h5-12H,3-4H2,1-2H3 |
| InChIKey | FVPQTVGBXSBNLL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|