C14H22N2O2 — CID 66709560
2,4-dimethoxy-7-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 66709560) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,4-dimethoxy-7-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 2,4-dimethoxy-7-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 66709560 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,4-dimethoxy-7-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | CCCCCC1CCc2c(OC)nc(OC)nc21 |
| InChI | InChI=1S/C14H22N2O2/c1-4-5-6-7-10-8-9-11-12(10)15-14(18-3)16-13(11)17-2/h10H,4-9H2,1-3H3 |
| InChIKey | GEJXFRNJMXHMGY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|