C11H18N2O2 — CID 10656072
4-ethyl-2,6-dimethoxy-5-propan-2-ylpyrimidine (PubChem CID 10656072) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethoxy-5-propan-2-ylpyrimidine.
| Compound Name | 4-ethyl-2,6-dimethoxy-5-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 10656072 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-ethyl-2,6-dimethoxy-5-propan-2-ylpyrimidine |
| SMILES | CCc1nc(OC)nc(OC)c1C(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-6-8-9(7(2)3)10(14-4)13-11(12-8)15-5/h7H,6H2,1-5H3 |
| InChIKey | HZBSKZKLAAQDCP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |