C9H14N2O3 — CID 46885005
2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethanol (PubChem CID 46885005) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethanol.
| Compound Name | 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethanol |
|---|---|
| PubChem CID | 46885005 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethanol |
| SMILES | COc1nc(C)c(CCO)c(OC)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-6-7(4-5-12)8(13-2)11-9(10-6)14-3/h12H,4-5H2,1-3H3 |
| InChIKey | NYLBZFJZFNGHSO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |