C9H13ClN2O2 — CID 46885143
5-(2-chloroethyl)-2,4-dimethoxy-6-methylpyrimidine (PubChem CID 46885143) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 5-(2-chloroethyl)-2,4-dimethoxy-6-methylpyrimidine.
| Compound Name | 5-(2-chloroethyl)-2,4-dimethoxy-6-methylpyrimidine |
|---|---|
| PubChem CID | 46885143 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-(2-chloroethyl)-2,4-dimethoxy-6-methylpyrimidine |
| SMILES | COc1nc(C)c(CCCl)c(OC)n1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-6-7(4-5-10)8(13-2)12-9(11-6)14-3/h4-5H2,1-3H3 |
| InChIKey | OWUWTYCMLFRVIT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|