C11H16N2O4 — CID 46885140
2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethyl acetate (PubChem CID 46885140) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethyl acetate.
| Compound Name | 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethyl acetate |
|---|---|
| PubChem CID | 46885140 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(2,4-dimethoxy-6-methylpyrimidin-5-yl)ethyl acetate |
| SMILES | COc1nc(C)c(CCOC(C)=O)c(OC)n1 |
| InChI | InChI=1S/C11H16N2O4/c1-7-9(5-6-17-8(2)14)10(15-3)13-11(12-7)16-4/h5-6H2,1-4H3 |
| InChIKey | NBDFBDZOMPGTQD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |