C10H5F3IN5S — CID 66716935
5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 66716935) has the molecular formula C10H5F3IN5S and a molecular weight of 411.15 g/mol. Its IUPAC name is 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66716935 |
| Molecular Formula | C10H5F3IN5S |
| Molecular Weight | 411.15 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2nn3cc(I)nc3s2)cc1C(F)(F)F |
| InChI | InChI=1S/C10H5F3IN5S/c11-10(12,13)5-1-4(2-16-7(5)15)8-18-19-3-6(14)17-9(19)20-8/h1-3H,(H2,15,16) |
| InChIKey | XHFZQIXTJFXKEE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|