C40H36Cl2N2O9S — CID 66719419
methyl (2S)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxin-6-yl]-2-[(4-nitrophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]propanoate (PubChem CID 66719419) has the molecular formula C40H36Cl2N2O9S and a molecular weight of 791.71 g/mol. Its IUPAC name is methyl (2S)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxin-6-yl]-2-[(4-nitrophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxin-6-yl]-2-[(4-nitrophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]propanoate |
|---|---|
| PubChem CID | 66719419 |
| Molecular Formula | C40H36Cl2N2O9S |
| Molecular Weight | 791.71 g/mol |
| Exact Mass | 790.15 |
| IUPAC Name | methyl (2S)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxin-6-yl]-2-[(4-nitrophenyl)sulfonyl-[(1S)-1-phenylpropyl]amino]propanoate |
| SMILES | CC[C@@H](c1ccccc1)N([C@@H](Cc1ccc2c(c1)OC[C@H](c1ccc(OCc3ccc(Cl)c(Cl)c3)cc1)O2)C(=O)OC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C40H36Cl2N2O9S/c1-3-35(28-7-5-4-6-8-28)43(54(48,49)32-17-13-30(14-18-32)44(46)47)36(40(45)50-2)22-26-10-20-37-38(23-26)52-25-39(53-37)29-11-15-31(16-12-29)51-24-27-9-19-33(41)34(42)21-27/h4-21,23,35-36,39H,3,22,24-25H2,1-2H3/t35-,36-,39+/m0/s1 |
| InChIKey | FVLLSXQHLDNFST-VHYZKNOSSA-N |
| XLogP | 8.92 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.71 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|