C16H19NO4 — CID 66720485
benzyl (3R)-3-amino-3-(2,5-dioxocyclopentyl)-2-methylpropanoate (PubChem CID 66720485) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is benzyl (3R)-3-amino-3-(2,5-dioxocyclopentyl)-2-methylpropanoate.
| Compound Name | benzyl (3R)-3-amino-3-(2,5-dioxocyclopentyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 66720485 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | benzyl (3R)-3-amino-3-(2,5-dioxocyclopentyl)-2-methylpropanoate |
| SMILES | CC(C(=O)OCc1ccccc1)[C@H](N)C1C(=O)CCC1=O |
| InChI | InChI=1S/C16H19NO4/c1-10(15(17)14-12(18)7-8-13(14)19)16(20)21-9-11-5-3-2-4-6-11/h2-6,10,14-15H,7-9,17H2,1H3/t10?,15-/m0/s1 |
| InChIKey | ZAAKEYWGTQJCBK-WRXSAAJRSA-N |
| XLogP | 1.24 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|