C19H20N2O5 — CID 66720573
1-[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 66720573) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 1-[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66720573 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cc(COc2cccc(N3C(=O)NC(=O)C3C)c2)cc(OC)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-18(22)20-19(23)21(12)14-5-4-6-15(9-14)26-11-13-7-16(24-2)10-17(8-13)25-3/h4-10,12H,11H2,1-3H3,(H,20,22,23) |
| InChIKey | IIOFKXCQZSPBTL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|