methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate

C9H9N3O2 — CID 66720768

IUPACmethyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
SMILESCOC(=O)c1cccc2nc(C)nn12
InChIInChI=1S/C9H9N3O2/c1-6-10-8-5-3-4-7(9(13)14-2)12(8)11-6/h3-5H,1-2H3
InChIKeyACRJRCYMTOKAOZ-UHFFFAOYSA-N
MW191.19 g/mol
LogP0.82
Rot. Bonds1

About methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate

methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate (PubChem CID 66720768) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
PubChem CID66720768
Molecular FormulaC9H9N3O2
Molecular Weight191.19 g/mol
Exact Mass191.07
IUPAC Namemethyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
SMILESCOC(=O)c1cccc2nc(C)nn12
InChIInChI=1S/C9H9N3O2/c1-6-10-8-5-3-4-7(9(13)14-2)12(8)11-6/h3-5H,1-2H3
InChIKeyACRJRCYMTOKAOZ-UHFFFAOYSA-N
XLogP0.82
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 50.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The IUPAC name of methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate (CID 66720768) is methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate.
What is the SMILES notation for methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The canonical SMILES for methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate is COC(=O)c1cccc2nc(C)nn12.
What is the InChIKey of methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The InChIKey is ACRJRCYMTOKAOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6-10-8-5-3-4-7(9(13)14-2)12(8)11-6/h3-5H,1-2H3.
What are the key properties of methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate has a molecular weight of 191.19 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate is sourced from PubChem (CID 66720768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).