C21H16F3NO4 — CID 66720930
methyl 5-hydroxy-6-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (PubChem CID 66720930) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is methyl 5-hydroxy-6-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-hydroxy-6-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66720930 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl 5-hydroxy-6-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(O)c(-c2ccc(C(F)(F)F)c(OCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C21H16F3NO4/c1-28-20(27)16-9-10-17(26)19(25-16)14-7-8-15(21(22,23)24)18(11-14)29-12-13-5-3-2-4-6-13/h2-11,26H,12H2,1H3 |
| InChIKey | PTGAUXNUMDQVMW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |