C20H28NO7P — CID 66725364
2-[6-phosphono-5-(2,3,5-trimethylindol-3-yl)hexyl]propanedioic acid (PubChem CID 66725364) has the molecular formula C20H28NO7P and a molecular weight of 425.42 g/mol. Its IUPAC name is 2-[6-phosphono-5-(2,3,5-trimethylindol-3-yl)hexyl]propanedioic acid.
| Compound Name | 2-[6-phosphono-5-(2,3,5-trimethylindol-3-yl)hexyl]propanedioic acid |
|---|---|
| PubChem CID | 66725364 |
| Molecular Formula | C20H28NO7P |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[6-phosphono-5-(2,3,5-trimethylindol-3-yl)hexyl]propanedioic acid |
| SMILES | CC1=Nc2ccc(C)cc2C1(C)C(CCCCC(C(=O)O)C(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C20H28NO7P/c1-12-8-9-17-16(10-12)20(3,13(2)21-17)14(11-29(26,27)28)6-4-5-7-15(18(22)23)19(24)25/h8-10,14-15H,4-7,11H2,1-3H3,(H,22,23)(H,24,25)(H2,26,27,28) |
| InChIKey | QNIFFMQZLGLOQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|