C26H36N2O4 — CID 66726345
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[[methoxy(phenyl)methyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 66726345) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[[methoxy(phenyl)methyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[[methoxy(phenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 66726345 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[[methoxy(phenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | COC(NC(C)CC(=O)N(Cc1ccc2c(c1)OCCCO2)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O4/c1-19(2)17-28(18-21-11-12-23-24(16-21)32-14-8-13-31-23)25(29)15-20(3)27-26(30-4)22-9-6-5-7-10-22/h5-7,9-12,16,19-20,26-27H,8,13-15,17-18H2,1-4H3 |
| InChIKey | YKPRSGKWYANPMO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|