About 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine
2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine (PubChem CID 66727020) has the molecular formula C17H24N4O2S2
and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine.
Molecular Properties
| Compound Name | 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine |
| PubChem CID | 66727020 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine |
| SMILES | CC1CCNCCN1S(=O)(=O)c1ccc2c(SCCN)nccc2c1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-13-4-7-19-9-10-21(13)25(22,23)15-2-3-16-14(12-15)5-8-20-17(16)24-11-6-18/h2-3,5,8,12-13,19H,4,6-7,9-11,18H2,1H3 |
| InChIKey | LARGJMRXZPGWOV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine?
The IUPAC name of 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine (CID 66727020) is 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine.
What is the SMILES notation for 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine?
The canonical SMILES for 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine is CC1CCNCCN1S(=O)(=O)c1ccc2c(SCCN)nccc2c1.
What is the InChIKey of 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine?
The InChIKey is LARGJMRXZPGWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2S2/c1-13-4-7-19-9-10-21(13)25(22,23)15-2-3-16-14(12-15)5-8-20-17(16)24-11-6-18/h2-3,5,8,12-13,19H,4,6-7,9-11,18H2,1H3.
What are the key properties of 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine?
2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine has a molecular weight of 380.54 g/mol, XLogP of 1.66, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(7-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinolin-1-yl]sulfanylethanamine is sourced from PubChem (CID 66727020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).