C10H18F3OP — CID 66729730
[ethyl(2,2,2-trifluoroethyl)phosphoryl]cyclohexane (PubChem CID 66729730) has the molecular formula C10H18F3OP and a molecular weight of 242.22 g/mol. Its IUPAC name is [ethyl(2,2,2-trifluoroethyl)phosphoryl]cyclohexane.
| Compound Name | [ethyl(2,2,2-trifluoroethyl)phosphoryl]cyclohexane |
|---|---|
| PubChem CID | 66729730 |
| Molecular Formula | C10H18F3OP |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | [ethyl(2,2,2-trifluoroethyl)phosphoryl]cyclohexane |
| SMILES | CCP(=O)(CC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3OP/c1-2-15(14,8-10(11,12)13)9-6-4-3-5-7-9/h9H,2-8H2,1H3 |
| InChIKey | GTRAZHITYJUVIU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|