C14H15ClN2O2 — CID 66732573
5-[(2R,4R)-2-(4-chlorophenyl)piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732573) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 5-[(2R,4R)-2-(4-chlorophenyl)piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2R,4R)-2-(4-chlorophenyl)piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 66732573 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-[(2R,4R)-2-(4-chlorophenyl)piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@@H]2CCN[C@@H](c3ccc(Cl)cc3)C2)o[nH]1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-11-3-1-9(2-4-11)12-7-10(5-6-16-12)13-8-14(18)17-19-13/h1-4,8,10,12,16H,5-7H2,(H,17,18)/t10-,12-/m1/s1 |
| InChIKey | HXFOYEDBEIMRCS-ZYHUDNBSSA-N |
| XLogP | 2.83 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |