About 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one
5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 46937638) has the molecular formula C10H14N6O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one |
| PubChem CID | 46937638 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | Cn1nnc([C@@H]2C[C@@H](c3cc(=O)[nH]o3)CCN2)n1 |
| InChI | InChI=1S/C10H14N6O2/c1-16-13-10(12-15-16)7-4-6(2-3-11-7)8-5-9(17)14-18-8/h5-7,11H,2-4H2,1H3,(H,14,17)/t6-,7-/m0/s1 |
| InChIKey | NWBVJFSOESAVGG-BQBZGAKWSA-N |
| XLogP | -0.30 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one?
The IUPAC name of 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one (CID 46937638) is 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one is Cn1nnc([C@@H]2C[C@@H](c3cc(=O)[nH]o3)CCN2)n1.
What is the InChIKey of 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one?
The InChIKey is NWBVJFSOESAVGG-BQBZGAKWSA-N. The full InChI is InChI=1S/C10H14N6O2/c1-16-13-10(12-15-16)7-4-6(2-3-11-7)8-5-9(17)14-18-8/h5-7,11H,2-4H2,1H3,(H,14,17)/t6-,7-/m0/s1.
What are the key properties of 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one?
5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one has a molecular weight of 250.26 g/mol, XLogP of -0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,4S)-2-(2-methyltetrazol-5-yl)piperidin-4-yl]-1,2-oxazol-3-one is sourced from PubChem (CID 46937638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).