C12H18O4 — CID 66735630
2-(furan-3-ylmethyl)-3-hydroxy-4,4-dimethylpentanoic acid (PubChem CID 66735630) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(furan-3-ylmethyl)-3-hydroxy-4,4-dimethylpentanoic acid.
| Compound Name | 2-(furan-3-ylmethyl)-3-hydroxy-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 66735630 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-(furan-3-ylmethyl)-3-hydroxy-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(O)C(Cc1ccoc1)C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-12(2,3)10(13)9(11(14)15)6-8-4-5-16-7-8/h4-5,7,9-10,13H,6H2,1-3H3,(H,14,15) |
| InChIKey | JYTXKUQKSYCRAS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |