C16H19NO4 — CID 66737451
(E,2R)-6-(6-methoxyquinolin-4-yl)oxyhex-4-ene-1,2-diol (PubChem CID 66737451) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (E,2R)-6-(6-methoxyquinolin-4-yl)oxyhex-4-ene-1,2-diol.
| Compound Name | (E,2R)-6-(6-methoxyquinolin-4-yl)oxyhex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 66737451 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E,2R)-6-(6-methoxyquinolin-4-yl)oxyhex-4-ene-1,2-diol |
| SMILES | COc1ccc2nccc(OC/C=C/C[C@@H](O)CO)c2c1 |
| InChI | InChI=1S/C16H19NO4/c1-20-13-5-6-15-14(10-13)16(7-8-17-15)21-9-3-2-4-12(19)11-18/h2-3,5-8,10,12,18-19H,4,9,11H2,1H3/b3-2+/t12-/m1/s1 |
| InChIKey | GZYCULFUBJJBFZ-QAVQXKDTSA-N |
| XLogP | 1.92 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|