C21H39NSi2 — CID 66742780
N,N-bis[tert-butyl(dimethyl)silyl]-1-(4-ethenylphenyl)methanamine (PubChem CID 66742780) has the molecular formula C21H39NSi2 and a molecular weight of 361.72 g/mol. Its IUPAC name is N,N-bis[tert-butyl(dimethyl)silyl]-1-(4-ethenylphenyl)methanamine.
| Compound Name | N,N-bis[tert-butyl(dimethyl)silyl]-1-(4-ethenylphenyl)methanamine |
|---|---|
| PubChem CID | 66742780 |
| Molecular Formula | C21H39NSi2 |
| Molecular Weight | 361.72 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N,N-bis[tert-butyl(dimethyl)silyl]-1-(4-ethenylphenyl)methanamine |
| SMILES | C=Cc1ccc(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H39NSi2/c1-12-18-13-15-19(16-14-18)17-22(23(8,9)20(2,3)4)24(10,11)21(5,6)7/h12-16H,1,17H2,2-11H3 |
| InChIKey | JUHVHDDBVZNXFP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|