C14H10ClN5O4 — CID 66743736
(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-(2,5-dioxopyrrolidin-1-yl)prop-2-enoic acid (PubChem CID 66743736) has the molecular formula C14H10ClN5O4 and a molecular weight of 347.72 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-(2,5-dioxopyrrolidin-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-(2,5-dioxopyrrolidin-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 66743736 |
| Molecular Formula | C14H10ClN5O4 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-(2,5-dioxopyrrolidin-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cc(Cl)ccc1-n1cnnn1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C14H10ClN5O4/c15-9-1-2-10(19-7-16-17-18-19)8(5-9)6-11(14(23)24)20-12(21)3-4-13(20)22/h1-2,5-7H,3-4H2,(H,23,24)/b11-6+ |
| InChIKey | JJJNNCHRYFKILB-IZZDOVSWSA-N |
| XLogP | 0.89 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|