C9H18O5 — CID 66745386
2-[2-(2-hydroxyethoxy)ethoxy]-2-(oxetan-2-yl)ethanol (PubChem CID 66745386) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-2-(oxetan-2-yl)ethanol.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-2-(oxetan-2-yl)ethanol |
|---|---|
| PubChem CID | 66745386 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-2-(oxetan-2-yl)ethanol |
| SMILES | OCCOCCOC(CO)C1CCO1 |
| InChI | InChI=1S/C9H18O5/c10-2-4-12-5-6-14-9(7-11)8-1-3-13-8/h8-11H,1-7H2 |
| InChIKey | KRCLMQPUYJPGQJ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|