C13H26O7 — CID 66746025
2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(oxetan-2-yl)ethanol (PubChem CID 66746025) has the molecular formula C13H26O7 and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(oxetan-2-yl)ethanol.
| Compound Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(oxetan-2-yl)ethanol |
|---|---|
| PubChem CID | 66746025 |
| Molecular Formula | C13H26O7 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(oxetan-2-yl)ethanol |
| SMILES | OCCOCCOCCOCCOC(CO)C1CCO1 |
| InChI | InChI=1S/C13H26O7/c14-2-4-16-5-6-17-7-8-18-9-10-20-13(11-15)12-1-3-19-12/h12-15H,1-11H2 |
| InChIKey | WUMAFXJXKKEKSD-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|