C11H18O7 — CID 88526857
3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(oxiran-2-yl)-2-oxopropanal (PubChem CID 88526857) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(oxiran-2-yl)-2-oxopropanal.
| Compound Name | 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(oxiran-2-yl)-2-oxopropanal |
|---|---|
| PubChem CID | 88526857 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(oxiran-2-yl)-2-oxopropanal |
| SMILES | O=CC(=O)C(OCCOCCOCCO)C1CO1 |
| InChI | InChI=1S/C11H18O7/c12-1-2-15-3-4-16-5-6-17-11(9(14)7-13)10-8-18-10/h7,10-12H,1-6,8H2 |
| InChIKey | HQVUQTLHIFDPEK-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|