C6H13NO4 — CID 175378786
2-amino-2-[2-(2-hydroxyethoxy)ethoxy]acetaldehyde (PubChem CID 175378786) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-amino-2-[2-(2-hydroxyethoxy)ethoxy]acetaldehyde.
| Compound Name | 2-amino-2-[2-(2-hydroxyethoxy)ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 175378786 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-amino-2-[2-(2-hydroxyethoxy)ethoxy]acetaldehyde |
| SMILES | NC(C=O)OCCOCCO |
| InChI | InChI=1S/C6H13NO4/c7-6(5-9)11-4-3-10-2-1-8/h5-6,8H,1-4,7H2 |
| InChIKey | ZLWOSSJDBKIVIP-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|