C12H17N3O4S2 — CID 66747198
5-(4-methylsulfinylbutoxy)-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-4-amine (PubChem CID 66747198) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-(4-methylsulfinylbutoxy)-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-4-amine.
| Compound Name | 5-(4-methylsulfinylbutoxy)-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 66747198 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-(4-methylsulfinylbutoxy)-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-4-amine |
| SMILES | CS(=O)CCCCOc1cccc2c1C(N)=NS(=O)(=O)N2 |
| InChI | InChI=1S/C12H17N3O4S2/c1-20(16)8-3-2-7-19-10-6-4-5-9-11(10)12(13)15-21(17,18)14-9/h4-6,14H,2-3,7-8H2,1H3,(H2,13,15) |
| InChIKey | CFSIBTJIWALZIS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|