C14H21N3O4S — CID 67414008
5-[(4-amino-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-5-yl)oxy]-2-ethylpentan-1-ol (PubChem CID 67414008) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-[(4-amino-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-5-yl)oxy]-2-ethylpentan-1-ol.
| Compound Name | 5-[(4-amino-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-5-yl)oxy]-2-ethylpentan-1-ol |
|---|---|
| PubChem CID | 67414008 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-[(4-amino-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-5-yl)oxy]-2-ethylpentan-1-ol |
| SMILES | CCC(CO)CCCOc1cccc2c1C(N)=NS(=O)(=O)N2 |
| InChI | InChI=1S/C14H21N3O4S/c1-2-10(9-18)5-4-8-21-12-7-3-6-11-13(12)14(15)17-22(19,20)16-11/h3,6-7,10,16,18H,2,4-5,8-9H2,1H3,(H2,15,17) |
| InChIKey | KDIQHFGSEPPUKC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|