C21H19N3O3S — CID 66747718
methyl 4-cyano-3-(isoquinolin-7-ylmethyl)-5-morpholin-4-ylthiophene-2-carboxylate (PubChem CID 66747718) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is methyl 4-cyano-3-(isoquinolin-7-ylmethyl)-5-morpholin-4-ylthiophene-2-carboxylate.
| Compound Name | methyl 4-cyano-3-(isoquinolin-7-ylmethyl)-5-morpholin-4-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 66747718 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | methyl 4-cyano-3-(isoquinolin-7-ylmethyl)-5-morpholin-4-ylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(N2CCOCC2)c(C#N)c1Cc1ccc2ccncc2c1 |
| InChI | InChI=1S/C21H19N3O3S/c1-26-21(25)19-17(11-14-2-3-15-4-5-23-13-16(15)10-14)18(12-22)20(28-19)24-6-8-27-9-7-24/h2-5,10,13H,6-9,11H2,1H3 |
| InChIKey | JATNLRMGCNPROM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |