C17H19NO4S — CID 667562
1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 667562) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 667562 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1OC |
| InChI | InChI=1S/C17H19NO4S/c1-21-16-10-9-14(12-17(16)22-2)23(19,20)18-11-5-7-13-6-3-4-8-15(13)18/h3-4,6,8-10,12H,5,7,11H2,1-2H3 |
| InChIKey | WZCJCYPLDJRLNS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |