C17H19NO4S — CID 667700
2-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 667700) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 667700 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1OC |
| InChI | InChI=1S/C17H19NO4S/c1-21-16-8-7-15(11-17(16)22-2)23(19,20)18-10-9-13-5-3-4-6-14(13)12-18/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | FLLSWGKZEVITMG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |