C16H19NO4S — CID 740562
3,4-dimethoxy-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 740562) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 740562 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3,4-dimethoxy-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C16H19NO4S/c1-20-15-9-8-14(12-16(15)21-2)22(18,19)17-11-10-13-6-4-3-5-7-13/h3-9,12,17H,10-11H2,1-2H3 |
| InChIKey | YQBJRUNQEJLDMV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |