C23H23N3O3S — CID 66757474
2-(benzenesulfonamido)-1-benzyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 66757474) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-1-benzyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 2-(benzenesulfonamido)-1-benzyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 66757474 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(benzenesulfonamido)-1-benzyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CCC(NS(=O)(=O)c1ccccc1)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H23N3O3S/c24-23(27)19-11-13-21-18(15-19)12-14-22(26(21)16-17-7-3-1-4-8-17)25-30(28,29)20-9-5-2-6-10-20/h1-11,13,15,22,25H,12,14,16H2,(H2,24,27) |
| InChIKey | FALCZJFTNRBAEJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |