C7H11N3O2 — CID 66763882
1-(2-aminopropyl)pyrimidine-2,4-dione (PubChem CID 66763882) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-(2-aminopropyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-aminopropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66763882 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-(2-aminopropyl)pyrimidine-2,4-dione |
| SMILES | CC(N)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H11N3O2/c1-5(8)4-10-3-2-6(11)9-7(10)12/h2-3,5H,4,8H2,1H3,(H,9,11,12) |
| InChIKey | CCWUXFXNCWVFRP-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |