C30H33N3O3 — CID 66766287
4-(4-hept-1-enyl-9H-pyrido[2,3-b]indol-6-yl)-N-[(4-methoxyphenyl)methyl]-4-oxobutanamide (PubChem CID 66766287) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-(4-hept-1-enyl-9H-pyrido[2,3-b]indol-6-yl)-N-[(4-methoxyphenyl)methyl]-4-oxobutanamide.
| Compound Name | 4-(4-hept-1-enyl-9H-pyrido[2,3-b]indol-6-yl)-N-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 66766287 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 4-(4-hept-1-enyl-9H-pyrido[2,3-b]indol-6-yl)-N-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
| SMILES | CCCCCC=Cc1ccnc2[nH]c3ccc(C(=O)CCC(=O)NCc4ccc(OC)cc4)cc3c12 |
| InChI | InChI=1S/C30H33N3O3/c1-3-4-5-6-7-8-22-17-18-31-30-29(22)25-19-23(11-14-26(25)33-30)27(34)15-16-28(35)32-20-21-9-12-24(36-2)13-10-21/h7-14,17-19H,3-6,15-16,20H2,1-2H3,(H,31,33)(H,32,35) |
| InChIKey | JTISZMCSGCXCFQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|