C30H28N2 — CID 68766438
4-[(E)-hept-1-enyl]-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 68766438) has the molecular formula C30H28N2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-[(E)-hept-1-enyl]-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole.
| Compound Name | 4-[(E)-hept-1-enyl]-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 68766438 |
| Molecular Formula | C30H28N2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[(E)-hept-1-enyl]-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | CCCCC/C=C/c1ccnc2[nH]c3ccc(-c4ccc(-c5ccccc5)cc4)cc3c12 |
| InChI | InChI=1S/C30H28N2/c1-2-3-4-5-7-12-25-19-20-31-30-29(25)27-21-26(17-18-28(27)32-30)24-15-13-23(14-16-24)22-10-8-6-9-11-22/h6-21H,2-5H2,1H3,(H,31,32)/b12-7+ |
| InChIKey | AWDZQMCJWMPRQN-KPKJPENVSA-N |
| XLogP | 8.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|