About 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole
2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 66766019) has the molecular formula C30H28N2
and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole |
| PubChem CID | 66766019 |
| Molecular Formula | C30H28N2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | CCCCCC=Cc1ccc2c(n1)[nH]c1ccc(-c3ccc(-c4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C30H28N2/c1-2-3-4-5-9-12-26-18-19-27-28-21-25(17-20-29(28)32-30(27)31-26)24-15-13-23(14-16-24)22-10-7-6-8-11-22/h6-21H,2-5H2,1H3,(H,31,32) |
| InChIKey | RMCHFECSKCNSLD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole?
The IUPAC name of 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole (CID 66766019) is 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole?
The canonical SMILES for 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole is CCCCCC=Cc1ccc2c(n1)[nH]c1ccc(-c3ccc(-c4ccccc4)cc3)cc12.
What is the InChIKey of 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole?
The InChIKey is RMCHFECSKCNSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2/c1-2-3-4-5-9-12-26-18-19-27-28-21-25(17-20-29(28)32-30(27)31-26)24-15-13-23(14-16-24)22-10-7-6-8-11-22/h6-21H,2-5H2,1H3,(H,31,32).
What are the key properties of 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole?
2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole has a molecular weight of 416.57 g/mol, XLogP of 8.64, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-1-enyl-6-(4-phenylphenyl)-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 66766019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).