C24H23N3O2 — CID 66766285
4-hept-1-enyl-6-(3-nitrophenyl)-9H-pyrido[2,3-b]indole (PubChem CID 66766285) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-hept-1-enyl-6-(3-nitrophenyl)-9H-pyrido[2,3-b]indole.
| Compound Name | 4-hept-1-enyl-6-(3-nitrophenyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 66766285 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-hept-1-enyl-6-(3-nitrophenyl)-9H-pyrido[2,3-b]indole |
| SMILES | CCCCCC=Cc1ccnc2[nH]c3ccc(-c4cccc([N+](=O)[O-])c4)cc3c12 |
| InChI | InChI=1S/C24H23N3O2/c1-2-3-4-5-6-8-17-13-14-25-24-23(17)21-16-19(11-12-22(21)26-24)18-9-7-10-20(15-18)27(28)29/h6-16H,2-5H2,1H3,(H,25,26) |
| InChIKey | YGOSKMHGMVXXPO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|