C25H20N2O2S — CID 66767412
2,6-bis(4-methoxyphenyl)-9-sulfanylpyrido[2,3-b]indole (PubChem CID 66767412) has the molecular formula C25H20N2O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-9-sulfanylpyrido[2,3-b]indole.
| Compound Name | 2,6-bis(4-methoxyphenyl)-9-sulfanylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 66767412 |
| Molecular Formula | C25H20N2O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-9-sulfanylpyrido[2,3-b]indole |
| SMILES | COc1ccc(-c2ccc3c(c2)c2ccc(-c4ccc(OC)cc4)nc2n3S)cc1 |
| InChI | InChI=1S/C25H20N2O2S/c1-28-19-8-3-16(4-9-19)18-7-14-24-22(15-18)21-12-13-23(26-25(21)27(24)30)17-5-10-20(29-2)11-6-17/h3-15,30H,1-2H3 |
| InChIKey | PIFKMAUUHKNHTI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 36.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|