C26H20N2O3S — CID 89094035
6-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]pyrido[2,3-b]indole-9-sulfinic acid (PubChem CID 89094035) has the molecular formula C26H20N2O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]pyrido[2,3-b]indole-9-sulfinic acid.
| Compound Name | 6-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]pyrido[2,3-b]indole-9-sulfinic acid |
|---|---|
| PubChem CID | 89094035 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]pyrido[2,3-b]indole-9-sulfinic acid |
| SMILES | COc1ccc(-c2ccc3c(c2)c2ccc(/C=C/c4ccccc4)nc2n3S(=O)O)cc1 |
| InChI | InChI=1S/C26H20N2O3S/c1-31-22-13-8-19(9-14-22)20-10-16-25-24(17-20)23-15-12-21(27-26(23)28(25)32(29)30)11-7-18-5-3-2-4-6-18/h2-17H,1H3,(H,29,30)/b11-7+ |
| InChIKey | HOOPZLQRQCRXOZ-YRNVUSSQSA-N |
| XLogP | 6.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|