About 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole
2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole (PubChem CID 66771388) has the molecular formula C21H21F3N2O
and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole.
Molecular Properties
| Compound Name | 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole |
| PubChem CID | 66771388 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole |
| SMILES | Cc1cccc([C@H](C)c2nccn2Cc2ccccc2OC(F)(F)F)c1C |
| InChI | InChI=1S/C21H21F3N2O/c1-14-7-6-9-18(15(14)2)16(3)20-25-11-12-26(20)13-17-8-4-5-10-19(17)27-21(22,23)24/h4-12,16H,13H2,1-3H3/t16-/m0/s1 |
| InChIKey | FHTBEMQEOYMWCD-INIZCTEOSA-N |
| XLogP | 5.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole?
The IUPAC name of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole (CID 66771388) is 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole.
What is the SMILES notation for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole?
The canonical SMILES for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole is Cc1cccc([C@H](C)c2nccn2Cc2ccccc2OC(F)(F)F)c1C.
What is the InChIKey of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole?
The InChIKey is FHTBEMQEOYMWCD-INIZCTEOSA-N. The full InChI is InChI=1S/C21H21F3N2O/c1-14-7-6-9-18(15(14)2)16(3)20-25-11-12-26(20)13-17-8-4-5-10-19(17)27-21(22,23)24/h4-12,16H,13H2,1-3H3/t16-/m0/s1.
What are the key properties of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole?
2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole has a molecular weight of 374.41 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[[2-(trifluoromethoxy)phenyl]methyl]imidazole is sourced from PubChem (CID 66771388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).