C23H24N4O3 — CID 66780749
N-[3-hydroxy-1-(1H-indol-3-yl)propyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide (PubChem CID 66780749) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[3-hydroxy-1-(1H-indol-3-yl)propyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide.
| Compound Name | N-[3-hydroxy-1-(1H-indol-3-yl)propyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66780749 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[3-hydroxy-1-(1H-indol-3-yl)propyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
| SMILES | CN(C(=O)C=Cc1cnc2c(c1)CCC(=O)N2)C(CCO)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N4O3/c1-27(20(10-11-28)18-14-24-19-5-3-2-4-17(18)19)22(30)9-6-15-12-16-7-8-21(29)26-23(16)25-13-15/h2-6,9,12-14,20,24,28H,7-8,10-11H2,1H3,(H,25,26,29) |
| InChIKey | VFBHTQPBSRESPN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|